C11H10F4O — CID 165347604
1-(2,3,5,6-tetrafluoro-4-propylphenyl)ethanone (PubChem CID 165347604) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluoro-4-propylphenyl)ethanone.
| Compound Name | 1-(2,3,5,6-tetrafluoro-4-propylphenyl)ethanone |
|---|---|
| PubChem CID | 165347604 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-propylphenyl)ethanone |
| SMILES | CCCc1c(F)c(F)c(C(C)=O)c(F)c1F |
| InChI | InChI=1S/C11H10F4O/c1-3-4-6-8(12)10(14)7(5(2)16)11(15)9(6)13/h3-4H2,1-2H3 |
| InChIKey | GJGVZSZIMXLEBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|