C6H5F5N2 — CID 172821602
azane;2,3,4,5,6-pentafluoroaniline (PubChem CID 172821602) has the molecular formula C6H5F5N2 and a molecular weight of 200.11 g/mol. Its IUPAC name is azane;2,3,4,5,6-pentafluoroaniline.
| Compound Name | azane;2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 172821602 |
| Molecular Formula | C6H5F5N2 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | azane;2,3,4,5,6-pentafluoroaniline |
| SMILES | N.Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6H2F5N.H3N/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H2;1H3 |
| InChIKey | UHMRXMWUZDXRTB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|