C6H5F4N3 — CID 146620564
2,3,4,5-tetrafluoro-6-hydrazinylaniline (PubChem CID 146620564) has the molecular formula C6H5F4N3 and a molecular weight of 195.12 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-hydrazinylaniline.
| Compound Name | 2,3,4,5-tetrafluoro-6-hydrazinylaniline |
|---|---|
| PubChem CID | 146620564 |
| Molecular Formula | C6H5F4N3 |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-hydrazinylaniline |
| SMILES | NNc1c(N)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6H5F4N3/c7-1-2(8)4(10)6(13-12)5(11)3(1)9/h13H,11-12H2 |
| InChIKey | OGBRPUQSFXCNOT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|