C6H5Br4N3 — CID 144606422
2,3,4,5-tetrabromo-6-hydrazinylaniline (PubChem CID 144606422) has the molecular formula C6H5Br4N3 and a molecular weight of 438.74 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-hydrazinylaniline.
| Compound Name | 2,3,4,5-tetrabromo-6-hydrazinylaniline |
|---|---|
| PubChem CID | 144606422 |
| Molecular Formula | C6H5Br4N3 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 434.72 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-hydrazinylaniline |
| SMILES | NNc1c(N)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C6H5Br4N3/c7-1-2(8)4(10)6(13-12)5(11)3(1)9/h13H,11-12H2 |
| InChIKey | CYJOYBGBXCGHMU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|