C7H3Cl2F4NO — CID 140996627
4-(dichloromethoxy)-2,3,5,6-tetrafluoroaniline (PubChem CID 140996627) has the molecular formula C7H3Cl2F4NO and a molecular weight of 264.00 g/mol. Its IUPAC name is 4-(dichloromethoxy)-2,3,5,6-tetrafluoroaniline.
| Compound Name | 4-(dichloromethoxy)-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 140996627 |
| Molecular Formula | C7H3Cl2F4NO |
| Molecular Weight | 264.00 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | 4-(dichloromethoxy)-2,3,5,6-tetrafluoroaniline |
| SMILES | Nc1c(F)c(F)c(OC(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C7H3Cl2F4NO/c8-7(9)15-6-3(12)1(10)5(14)2(11)4(6)13/h7H,14H2 |
| InChIKey | NHVVSZHORHKORT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.00 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|