C9H7F5N2O2 — CID 76915183
N'-hydroxy-2-(2,3,4,5,6-pentafluorophenoxy)propanimidamide (PubChem CID 76915183) has the molecular formula C9H7F5N2O2 and a molecular weight of 270.16 g/mol. Its IUPAC name is N'-hydroxy-2-(2,3,4,5,6-pentafluorophenoxy)propanimidamide.
| Compound Name | N'-hydroxy-2-(2,3,4,5,6-pentafluorophenoxy)propanimidamide |
|---|---|
| PubChem CID | 76915183 |
| Molecular Formula | C9H7F5N2O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | N'-hydroxy-2-(2,3,4,5,6-pentafluorophenoxy)propanimidamide |
| SMILES | CC(Oc1c(F)c(F)c(F)c(F)c1F)C(N)=NO |
| InChI | InChI=1S/C9H7F5N2O2/c1-2(9(15)16-17)18-8-6(13)4(11)3(10)5(12)7(8)14/h2,17H,1H3,(H2,15,16) |
| InChIKey | FHNFSTJBPAHFOO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|