C13H17BrN2O3 — CID 88841673
2-[(2,3-dimethyl-1-benzofuran-7-yl)oxy]-N'-hydroxypropanimidamide;hydrobromide (PubChem CID 88841673) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-1-benzofuran-7-yl)oxy]-N'-hydroxypropanimidamide;hydrobromide.
| Compound Name | 2-[(2,3-dimethyl-1-benzofuran-7-yl)oxy]-N'-hydroxypropanimidamide;hydrobromide |
|---|---|
| PubChem CID | 88841673 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[(2,3-dimethyl-1-benzofuran-7-yl)oxy]-N'-hydroxypropanimidamide;hydrobromide |
| SMILES | Br.Cc1oc2c(OC(C)C(N)=NO)cccc2c1C |
| InChI | InChI=1S/C13H16N2O3.BrH/c1-7-8(2)18-12-10(7)5-4-6-11(12)17-9(3)13(14)15-16;/h4-6,9,16H,1-3H3,(H2,14,15);1H |
| InChIKey | VMCCLXOTSXEGEF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|