C3H8N2O2 — CID 5063567
N',2-dihydroxypropanimidamide (PubChem CID 5063567) has the molecular formula C3H8N2O2 and a molecular weight of 104.11 g/mol. Its IUPAC name is N',2-dihydroxypropanimidamide.
| Compound Name | N',2-dihydroxypropanimidamide |
|---|---|
| PubChem CID | 5063567 |
| Molecular Formula | C3H8N2O2 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | N',2-dihydroxypropanimidamide |
| SMILES | CC(O)C(N)=NO |
| InChI | InChI=1S/C3H8N2O2/c1-2(6)3(4)5-7/h2,6-7H,1H3,(H2,4,5) |
| InChIKey | TWQGERCRJDBWSY-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|