About 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene
1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene (PubChem CID 118835991) has the molecular formula C7HCl2F5O
and a molecular weight of 266.98 g/mol. Its IUPAC name is 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene.
Molecular Properties
| Compound Name | 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene |
| PubChem CID | 118835991 |
| Molecular Formula | C7HCl2F5O |
| Molecular Weight | 266.98 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene |
| SMILES | Fc1c(F)c(OC(F)F)c(F)c(Cl)c1Cl |
| InChI | InChI=1S/C7HCl2F5O/c8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h7H |
| InChIKey | GCTXXNKOIRBOMK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.98 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene?
The IUPAC name of 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene (CID 118835991) is 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene.
What is the SMILES notation for 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene?
The canonical SMILES for 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene is Fc1c(F)c(OC(F)F)c(F)c(Cl)c1Cl.
What is the InChIKey of 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene?
The InChIKey is GCTXXNKOIRBOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HCl2F5O/c8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h7H.
What are the key properties of 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene?
1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene has a molecular weight of 266.98 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4-(difluoromethoxy)-3,5,6-trifluorobenzene is sourced from PubChem (CID 118835991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).