C8H4Cl2F2O2 — CID 121228177
3,6-dichloro-2-(difluoromethoxy)benzaldehyde (PubChem CID 121228177) has the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. Its IUPAC name is 3,6-dichloro-2-(difluoromethoxy)benzaldehyde.
| Compound Name | 3,6-dichloro-2-(difluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 121228177 |
| Molecular Formula | C8H4Cl2F2O2 |
| Molecular Weight | 241.02 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | 3,6-dichloro-2-(difluoromethoxy)benzaldehyde |
| SMILES | O=Cc1c(Cl)ccc(Cl)c1OC(F)F |
| InChI | InChI=1S/C8H4Cl2F2O2/c9-5-1-2-6(10)7(4(5)3-13)14-8(11)12/h1-3,8H |
| InChIKey | KESHYSCRQDYNGD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|