C9H6Cl2F2O3 — CID 119020580
2-[2,4-dichloro-3-(difluoromethoxy)phenyl]acetic acid (PubChem CID 119020580) has the molecular formula C9H6Cl2F2O3 and a molecular weight of 271.05 g/mol. Its IUPAC name is 2-[2,4-dichloro-3-(difluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[2,4-dichloro-3-(difluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 119020580 |
| Molecular Formula | C9H6Cl2F2O3 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 2-[2,4-dichloro-3-(difluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Cl)c(OC(F)F)c1Cl |
| InChI | InChI=1S/C9H6Cl2F2O3/c10-5-2-1-4(3-6(14)15)7(11)8(5)16-9(12)13/h1-2,9H,3H2,(H,14,15) |
| InChIKey | HZQRWHJIBFBTGS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |