C10H9ClF2O3 — CID 171005263
2-[5-chloro-2-(difluoromethoxy)-3-methylphenyl]acetic acid (PubChem CID 171005263) has the molecular formula C10H9ClF2O3 and a molecular weight of 250.63 g/mol. Its IUPAC name is 2-[5-chloro-2-(difluoromethoxy)-3-methylphenyl]acetic acid.
| Compound Name | 2-[5-chloro-2-(difluoromethoxy)-3-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 171005263 |
| Molecular Formula | C10H9ClF2O3 |
| Molecular Weight | 250.63 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-[5-chloro-2-(difluoromethoxy)-3-methylphenyl]acetic acid |
| SMILES | Cc1cc(Cl)cc(CC(=O)O)c1OC(F)F |
| InChI | InChI=1S/C10H9ClF2O3/c1-5-2-7(11)3-6(4-8(14)15)9(5)16-10(12)13/h2-3,10H,4H2,1H3,(H,14,15) |
| InChIKey | OXLWMQQXVPVLOE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |