C9H6ClF2NO5 — CID 171007645
2-[5-chloro-3-(difluoromethoxy)-2-nitrophenyl]acetic acid (PubChem CID 171007645) has the molecular formula C9H6ClF2NO5 and a molecular weight of 281.60 g/mol. Its IUPAC name is 2-[5-chloro-3-(difluoromethoxy)-2-nitrophenyl]acetic acid.
| Compound Name | 2-[5-chloro-3-(difluoromethoxy)-2-nitrophenyl]acetic acid |
|---|---|
| PubChem CID | 171007645 |
| Molecular Formula | C9H6ClF2NO5 |
| Molecular Weight | 281.60 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-[5-chloro-3-(difluoromethoxy)-2-nitrophenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Cl)cc(OC(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6ClF2NO5/c10-5-1-4(2-7(14)15)8(13(16)17)6(3-5)18-9(11)12/h1,3,9H,2H2,(H,14,15) |
| InChIKey | NEAXAGVCIWJRBR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|