C7HCl3F6 — CID 88844681
chloroform;1,2,3,4,5,6-hexafluorobenzene (PubChem CID 88844681) has the molecular formula C7HCl3F6 and a molecular weight of 305.43 g/mol. Its IUPAC name is chloroform;1,2,3,4,5,6-hexafluorobenzene.
| Compound Name | chloroform;1,2,3,4,5,6-hexafluorobenzene |
|---|---|
| PubChem CID | 88844681 |
| Molecular Formula | C7HCl3F6 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 303.90 |
| IUPAC Name | chloroform;1,2,3,4,5,6-hexafluorobenzene |
| SMILES | ClC(Cl)Cl.Fc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6F6.CHCl3/c7-1-2(8)4(10)6(12)5(11)3(1)9;2-1(3)4/h;1H |
| InChIKey | SKZLYOBYEQTZSY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|