C8HCl2F5O — CID 146007729
2,2-dichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 146007729) has the molecular formula C8HCl2F5O and a molecular weight of 278.99 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 2,2-dichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 146007729 |
| Molecular Formula | C8HCl2F5O |
| Molecular Weight | 278.99 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | 2,2-dichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)C(Cl)Cl |
| InChI | InChI=1S/C8HCl2F5O/c9-8(10)7(16)1-2(11)4(13)6(15)5(14)3(1)12/h8H |
| InChIKey | TUEOFCQBBKWZAN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|