C7HF5KNO — CID 171919116
potassium (2,3,4,5,6-pentafluorobenzoyl)azanide (PubChem CID 171919116) has the molecular formula C7HF5KNO and a molecular weight of 249.18 g/mol. Its IUPAC name is potassium (2,3,4,5,6-pentafluorobenzoyl)azanide.
| Compound Name | potassium (2,3,4,5,6-pentafluorobenzoyl)azanide |
|---|---|
| PubChem CID | 171919116 |
| Molecular Formula | C7HF5KNO |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | potassium (2,3,4,5,6-pentafluorobenzoyl)azanide |
| SMILES | [K+].[NH-]C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H2F5NO.K/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;/h(H2,13,14);/q;+1/p-1 |
| InChIKey | OSMZMADTXDOCRZ-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|