C15H2CuF10O2 — CID 159338327
1,3-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-dione;copper (PubChem CID 159338327) has the molecular formula C15H2CuF10O2 and a molecular weight of 467.71 g/mol. Its IUPAC name is 1,3-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-dione;copper.
| Compound Name | 1,3-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-dione;copper |
|---|---|
| PubChem CID | 159338327 |
| Molecular Formula | C15H2CuF10O2 |
| Molecular Weight | 467.71 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | 1,3-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-dione;copper |
| SMILES | O=C(CC(=O)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F.[Cu] |
| InChI | InChI=1S/C15H2F10O2.Cu/c16-6-4(7(17)11(21)14(24)10(6)20)2(26)1-3(27)5-8(18)12(22)15(25)13(23)9(5)19;/h1H2; |
| InChIKey | LFVCUOBCZVYNKR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|