C14H13F5O — CID 146007743
3-cyclopentyl-1-(2,3,4,5,6-pentafluorophenyl)propan-1-one (PubChem CID 146007743) has the molecular formula C14H13F5O and a molecular weight of 292.25 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,3,4,5,6-pentafluorophenyl)propan-1-one.
| Compound Name | 3-cyclopentyl-1-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 146007743 |
| Molecular Formula | C14H13F5O |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-cyclopentyl-1-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
| SMILES | O=C(CCC1CCCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H13F5O/c15-10-9(11(16)13(18)14(19)12(10)17)8(20)6-5-7-3-1-2-4-7/h7H,1-6H2 |
| InChIKey | OQZRFPSXXOOCSR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|