C14H21NO — CID 163213475
3-cyclohexyl-1-(1-methylpyrrol-2-yl)propan-1-one (PubChem CID 163213475) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-cyclohexyl-1-(1-methylpyrrol-2-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(1-methylpyrrol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 163213475 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-cyclohexyl-1-(1-methylpyrrol-2-yl)propan-1-one |
| SMILES | Cn1cccc1C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C14H21NO/c1-15-11-5-8-13(15)14(16)10-9-12-6-3-2-4-7-12/h5,8,11-12H,2-4,6-7,9-10H2,1H3 |
| InChIKey | VKTLTVQPNPPLSB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |