C13H19NOS — CID 63119820
2-(cyclopentylmethylsulfanyl)-1-(1-methylpyrrol-2-yl)ethanone (PubChem CID 63119820) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-(cyclopentylmethylsulfanyl)-1-(1-methylpyrrol-2-yl)ethanone.
| Compound Name | 2-(cyclopentylmethylsulfanyl)-1-(1-methylpyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 63119820 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(cyclopentylmethylsulfanyl)-1-(1-methylpyrrol-2-yl)ethanone |
| SMILES | Cn1cccc1C(=O)CSCC1CCCC1 |
| InChI | InChI=1S/C13H19NOS/c1-14-8-4-7-12(14)13(15)10-16-9-11-5-2-3-6-11/h4,7-8,11H,2-3,5-6,9-10H2,1H3 |
| InChIKey | NRYAKEPQXHYKMF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |