C8H2F5IO — CID 89355584
2-iodo-1-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 89355584) has the molecular formula C8H2F5IO and a molecular weight of 336.00 g/mol. Its IUPAC name is 2-iodo-1-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 2-iodo-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 89355584 |
| Molecular Formula | C8H2F5IO |
| Molecular Weight | 336.00 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | 2-iodo-1-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | O=C(CI)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H2F5IO/c9-4-3(2(15)1-14)5(10)7(12)8(13)6(4)11/h1H2 |
| InChIKey | BUMWXNDOVJJKRQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.00 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|