C17H6F10O2 — CID 12687568
1,5-bis(2,3,4,5,6-pentafluorophenyl)pentane-1,5-dione (PubChem CID 12687568) has the molecular formula C17H6F10O2 and a molecular weight of 432.21 g/mol. Its IUPAC name is 1,5-bis(2,3,4,5,6-pentafluorophenyl)pentane-1,5-dione.
| Compound Name | 1,5-bis(2,3,4,5,6-pentafluorophenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 12687568 |
| Molecular Formula | C17H6F10O2 |
| Molecular Weight | 432.21 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1,5-bis(2,3,4,5,6-pentafluorophenyl)pentane-1,5-dione |
| SMILES | O=C(CCCC(=O)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H6F10O2/c18-8-6(9(19)13(23)16(26)12(8)22)4(28)2-1-3-5(29)7-10(20)14(24)17(27)15(25)11(7)21/h1-3H2 |
| InChIKey | MODFOQUPMPODKT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.21 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|