C7Cl2F5NO — CID 12568720
N,N-dichloro-2,3,4,5,6-pentafluorobenzamide (PubChem CID 12568720) has the molecular formula C7Cl2F5NO and a molecular weight of 279.98 g/mol. Its IUPAC name is N,N-dichloro-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N,N-dichloro-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 12568720 |
| Molecular Formula | C7Cl2F5NO |
| Molecular Weight | 279.98 g/mol |
| Exact Mass | 278.93 |
| IUPAC Name | N,N-dichloro-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N(Cl)Cl |
| InChI | InChI=1S/C7Cl2F5NO/c8-15(9)7(16)1-2(10)4(12)6(14)5(13)3(1)11 |
| InChIKey | IYPCDXMYBPKVSJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.98 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|