C13H11ClF5NO — CID 102872717
N-(2-chloroethyl)-N-cyclobutyl-2,3,4,5,6-pentafluorobenzamide (PubChem CID 102872717) has the molecular formula C13H11ClF5NO and a molecular weight of 327.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclobutyl-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(2-chloroethyl)-N-cyclobutyl-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 102872717 |
| Molecular Formula | C13H11ClF5NO |
| Molecular Weight | 327.68 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclobutyl-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N(CCCl)C1CCC1 |
| InChI | InChI=1S/C13H11ClF5NO/c14-4-5-20(6-2-1-3-6)13(21)7-8(15)10(17)12(19)11(18)9(7)16/h6H,1-5H2 |
| InChIKey | SMDRXNSLXHZTRG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|