C13H13F5N2O — CID 43607904
N-(3-aminopropyl)-N-cyclopropyl-2,3,4,5,6-pentafluorobenzamide (PubChem CID 43607904) has the molecular formula C13H13F5N2O and a molecular weight of 308.25 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-cyclopropyl-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(3-aminopropyl)-N-cyclopropyl-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 43607904 |
| Molecular Formula | C13H13F5N2O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(3-aminopropyl)-N-cyclopropyl-2,3,4,5,6-pentafluorobenzamide |
| SMILES | NCCCN(C(=O)c1c(F)c(F)c(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C13H13F5N2O/c14-8-7(9(15)11(17)12(18)10(8)16)13(21)20(5-1-4-19)6-2-3-6/h6H,1-5,19H2 |
| InChIKey | TXRQWCSJRBJLBI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|