C13H15F3N2O — CID 102874150
N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzamide (PubChem CID 102874150) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzamide.
| Compound Name | N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 102874150 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzamide |
| SMILES | NCCN(C(=O)c1c(F)cc(F)cc1F)C1CCC1 |
| InChI | InChI=1S/C13H15F3N2O/c14-8-6-10(15)12(11(16)7-8)13(19)18(5-4-17)9-2-1-3-9/h6-7,9H,1-5,17H2 |
| InChIKey | HLBTZOGPTUSSRB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |