C12H15F3N2O2S — CID 102874463
N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzenesulfonamide (PubChem CID 102874463) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 102874463 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(2-aminoethyl)-N-cyclobutyl-2,4,6-trifluorobenzenesulfonamide |
| SMILES | NCCN(C1CCC1)S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O2S/c13-8-6-10(14)12(11(15)7-8)20(18,19)17(5-4-16)9-2-1-3-9/h6-7,9H,1-5,16H2 |
| InChIKey | YKYWYFGZRWLURW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |