C16H24N2O — CID 63755882
N-(2-aminoethyl)-N-cyclopentyl-3,5-dimethylbenzamide (PubChem CID 63755882) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-cyclopentyl-3,5-dimethylbenzamide.
| Compound Name | N-(2-aminoethyl)-N-cyclopentyl-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 63755882 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(2-aminoethyl)-N-cyclopentyl-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(CCN)C2CCCC2)c1 |
| InChI | InChI=1S/C16H24N2O/c1-12-9-13(2)11-14(10-12)16(19)18(8-7-17)15-5-3-4-6-15/h9-11,15H,3-8,17H2,1-2H3 |
| InChIKey | PNMDNNBFTWQOSJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |