C16H22N2O2 — CID 47212500
N-(2-amino-2-oxoethyl)-N-cyclopentyl-3,5-dimethylbenzamide (PubChem CID 47212500) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-cyclopentyl-3,5-dimethylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-cyclopentyl-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 47212500 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-cyclopentyl-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(CC(N)=O)C2CCCC2)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-11-7-12(2)9-13(8-11)16(20)18(10-15(17)19)14-5-3-4-6-14/h7-9,14H,3-6,10H2,1-2H3,(H2,17,19) |
| InChIKey | VUZYVJOKVUAUFX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |