C11H15ClN2O2 — CID 63391687
N-(2-chloroethyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide (PubChem CID 63391687) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 63391687 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclopentyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(c1ccon1)N(CCCl)C1CCCC1 |
| InChI | InChI=1S/C11H15ClN2O2/c12-6-7-14(9-3-1-2-4-9)11(15)10-5-8-16-13-10/h5,8-9H,1-4,6-7H2 |
| InChIKey | DKYVQOWTRGVHRG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|