C12H19N3O2 — CID 63638830
N-piperidin-3-yl-N-propyl-1,2-oxazole-3-carboxamide (PubChem CID 63638830) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-piperidin-3-yl-N-propyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-piperidin-3-yl-N-propyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 63638830 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-piperidin-3-yl-N-propyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCN(C(=O)c1ccon1)C1CCCNC1 |
| InChI | InChI=1S/C12H19N3O2/c1-2-7-15(10-4-3-6-13-9-10)12(16)11-5-8-17-14-11/h5,8,10,13H,2-4,6-7,9H2,1H3 |
| InChIKey | VBYOOBCVPHPGPY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |