C8Cl2F4O2 — CID 18764629
2,4,5,6-tetrafluorobenzene-1,3-dicarbonyl chloride (PubChem CID 18764629) has the molecular formula C8Cl2F4O2 and a molecular weight of 274.98 g/mol. Its IUPAC name is 2,4,5,6-tetrafluorobenzene-1,3-dicarbonyl chloride.
| Compound Name | 2,4,5,6-tetrafluorobenzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 18764629 |
| Molecular Formula | C8Cl2F4O2 |
| Molecular Weight | 274.98 g/mol |
| Exact Mass | 273.92 |
| IUPAC Name | 2,4,5,6-tetrafluorobenzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1c(F)c(F)c(F)c(C(=O)Cl)c1F |
| InChI | InChI=1S/C8Cl2F4O2/c9-7(15)1-3(11)2(8(10)16)5(13)6(14)4(1)12 |
| InChIKey | KKENYPMBRJYGTH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.98 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|