C7H2F5NaO3 — CID 155734252
sodium;2,3,4,5,6-pentafluorobenzoate;hydrate (PubChem CID 155734252) has the molecular formula C7H2F5NaO3 and a molecular weight of 252.07 g/mol. Its IUPAC name is sodium;2,3,4,5,6-pentafluorobenzoate;hydrate.
| Compound Name | sodium;2,3,4,5,6-pentafluorobenzoate;hydrate |
|---|---|
| PubChem CID | 155734252 |
| Molecular Formula | C7H2F5NaO3 |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | sodium;2,3,4,5,6-pentafluorobenzoate;hydrate |
| SMILES | O.O=C([O-])c1c(F)c(F)c(F)c(F)c1F.[Na+] |
| InChI | InChI=1S/C7HF5O2.Na.H2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;;/h(H,13,14);;1H2/q;+1;/p-1 |
| InChIKey | NGKIPAQAYVZRSH-UHFFFAOYSA-M |
| XLogP | -3.08 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|