C8I4Na2O4 — CID 21150477
disodium;3,4,5,6-tetraiodophthalate (PubChem CID 21150477) has the molecular formula C8I4Na2O4 and a molecular weight of 713.68 g/mol. Its IUPAC name is disodium;3,4,5,6-tetraiodophthalate.
| Compound Name | disodium;3,4,5,6-tetraiodophthalate |
|---|---|
| PubChem CID | 21150477 |
| Molecular Formula | C8I4Na2O4 |
| Molecular Weight | 713.68 g/mol |
| Exact Mass | 713.58 |
| IUPAC Name | disodium;3,4,5,6-tetraiodophthalate |
| SMILES | O=C([O-])c1c(I)c(I)c(I)c(I)c1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H2I4O4.2Na/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;;/h(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | XTSLSEFQGOMLNN-UHFFFAOYSA-L |
| XLogP | -5.16 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.68 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|