C7I5O2- — CID 140821752
2,3,4,5,6-pentaiodobenzoate (PubChem CID 140821752) has the molecular formula C7I5O2- and a molecular weight of 750.59 g/mol. Its IUPAC name is 2,3,4,5,6-pentaiodobenzoate.
| Compound Name | 2,3,4,5,6-pentaiodobenzoate |
|---|---|
| PubChem CID | 140821752 |
| Molecular Formula | C7I5O2- |
| Molecular Weight | 750.59 g/mol |
| Exact Mass | 750.51 |
| IUPAC Name | 2,3,4,5,6-pentaiodobenzoate |
| SMILES | O=C([O-])c1c(I)c(I)c(I)c(I)c1I |
| InChI | InChI=1S/C7HI5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14)/p-1 |
| InChIKey | LNLWJOZRHQPFML-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|