C8CaCl4O4 — CID 22119341
calcium 3,4,5,6-tetrachlorophthalate (PubChem CID 22119341) has the molecular formula C8CaCl4O4 and a molecular weight of 341.97 g/mol. Its IUPAC name is calcium 3,4,5,6-tetrachlorophthalate.
| Compound Name | calcium 3,4,5,6-tetrachlorophthalate |
|---|---|
| PubChem CID | 22119341 |
| Molecular Formula | C8CaCl4O4 |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 339.82 |
| IUPAC Name | calcium 3,4,5,6-tetrachlorophthalate |
| SMILES | O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C8H2Cl4O4.Ca/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;/h(H,13,14)(H,15,16);/q;+2/p-2 |
| InChIKey | SFPILOGVGHIRAT-UHFFFAOYSA-L |
| XLogP | 0.65 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|