C8I4O4-2 — CID 18993874
2,3,5,6-tetraiodoterephthalate (PubChem CID 18993874) has the molecular formula C8I4O4-2 and a molecular weight of 667.70 g/mol. Its IUPAC name is 2,3,5,6-tetraiodoterephthalate.
| Compound Name | 2,3,5,6-tetraiodoterephthalate |
|---|---|
| PubChem CID | 18993874 |
| Molecular Formula | C8I4O4-2 |
| Molecular Weight | 667.70 g/mol |
| Exact Mass | 667.60 |
| IUPAC Name | 2,3,5,6-tetraiodoterephthalate |
| SMILES | O=C([O-])c1c(I)c(I)c(C(=O)[O-])c(I)c1I |
| InChI | InChI=1S/C8H2I4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16)/p-2 |
| InChIKey | INPWHIBRMNBPDX-UHFFFAOYSA-L |
| XLogP | 0.83 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.70 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|