About 3,5-diamino-2,4,6-triiodobenzoate
3,5-diamino-2,4,6-triiodobenzoate (PubChem CID 18783410) has the molecular formula C7H4I3N2O2-
and a molecular weight of 528.83 g/mol. Its IUPAC name is 3,5-diamino-2,4,6-triiodobenzoate.
Molecular Properties
| Compound Name | 3,5-diamino-2,4,6-triiodobenzoate |
| PubChem CID | 18783410 |
| Molecular Formula | C7H4I3N2O2- |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 528.74 |
| IUPAC Name | 3,5-diamino-2,4,6-triiodobenzoate |
| SMILES | Nc1c(I)c(N)c(I)c(C(=O)[O-])c1I |
| InChI | InChI=1S/C7H5I3N2O2/c8-2-1(7(13)14)3(9)6(12)4(10)5(2)11/h11-12H2,(H,13,14)/p-1 |
| InChIKey | GOQCZMZLABPEME-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-2,4,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-2,4,6-triiodobenzoate?
The IUPAC name of 3,5-diamino-2,4,6-triiodobenzoate (CID 18783410) is 3,5-diamino-2,4,6-triiodobenzoate.
What is the SMILES notation for 3,5-diamino-2,4,6-triiodobenzoate?
The canonical SMILES for 3,5-diamino-2,4,6-triiodobenzoate is Nc1c(I)c(N)c(I)c(C(=O)[O-])c1I.
What is the InChIKey of 3,5-diamino-2,4,6-triiodobenzoate?
The InChIKey is GOQCZMZLABPEME-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5I3N2O2/c8-2-1(7(13)14)3(9)6(12)4(10)5(2)11/h11-12H2,(H,13,14)/p-1.
What are the key properties of 3,5-diamino-2,4,6-triiodobenzoate?
3,5-diamino-2,4,6-triiodobenzoate has a molecular weight of 528.83 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-2,4,6-triiodobenzoate is sourced from PubChem (CID 18783410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).