C7H4I3N2O2- — CID 18783410
3,5-diamino-2,4,6-triiodobenzoate (PubChem CID 18783410) has the molecular formula C7H4I3N2O2- and a molecular weight of 528.83 g/mol. Its IUPAC name is 3,5-diamino-2,4,6-triiodobenzoate.
| Compound Name | 3,5-diamino-2,4,6-triiodobenzoate |
|---|---|
| PubChem CID | 18783410 |
| Molecular Formula | C7H4I3N2O2- |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 528.74 |
| IUPAC Name | 3,5-diamino-2,4,6-triiodobenzoate |
| SMILES | Nc1c(I)c(N)c(I)c(C(=O)[O-])c1I |
| InChI | InChI=1S/C7H5I3N2O2/c8-2-1(7(13)14)3(9)6(12)4(10)5(2)11/h11-12H2,(H,13,14)/p-1 |
| InChIKey | GOQCZMZLABPEME-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|