C16H11I3N2O8 — CID 159545650
5-aminobenzene-1,3-dicarboxylic acid;5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid (PubChem CID 159545650) has the molecular formula C16H11I3N2O8 and a molecular weight of 739.98 g/mol. Its IUPAC name is 5-aminobenzene-1,3-dicarboxylic acid;5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid.
| Compound Name | 5-aminobenzene-1,3-dicarboxylic acid;5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159545650 |
| Molecular Formula | C16H11I3N2O8 |
| Molecular Weight | 739.98 g/mol |
| Exact Mass | 739.76 |
| IUPAC Name | 5-aminobenzene-1,3-dicarboxylic acid;5-amino-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
| SMILES | Nc1c(I)c(C(=O)O)c(I)c(C(=O)O)c1I.Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C8H4I3NO4.C8H7NO4/c9-3-1(7(13)14)4(10)6(12)5(11)2(3)8(15)16;9-6-2-4(7(10)11)1-5(3-6)8(12)13/h12H2,(H,13,14)(H,15,16);1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | METNUZYKZAYVEC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.98 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|