C16H6Cl8O9 — CID 155487673
bis(3,4,5,6-tetrachlorophthalic acid);hydrate (PubChem CID 155487673) has the molecular formula C16H6Cl8O9 and a molecular weight of 625.84 g/mol. Its IUPAC name is bis(3,4,5,6-tetrachlorophthalic acid);hydrate.
| Compound Name | bis(3,4,5,6-tetrachlorophthalic acid);hydrate |
|---|---|
| PubChem CID | 155487673 |
| Molecular Formula | C16H6Cl8O9 |
| Molecular Weight | 625.84 g/mol |
| Exact Mass | 621.75 |
| IUPAC Name | bis(3,4,5,6-tetrachlorophthalic acid);hydrate |
| SMILES | O.O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O.O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/2C8H2Cl4O4.H2O/c2*9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;/h2*(H,13,14)(H,15,16);1H2 |
| InChIKey | QODVBDRDMYDLOT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 180.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.84 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|