2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid

C14H4Cl4O8 — CID 174715214

IUPAC2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid
SMILESO=C(O)c1c(C(=O)O)c(Cl)c2c(C(=O)O)c(Cl)c(Cl)c(C(=O)O)c2c1Cl
InChIInChI=1S/C14H4Cl4O8/c15-7-1-2(8(16)6(14(25)26)5(7)13(23)24)4(12(21)22)10(18)9(17)3(1)11(19)20/h(H,19,20)(H,21,22)(H,23,24)(H,25,26)
InChIKeyBRYMFEHKKKKSRX-UHFFFAOYSA-N
MW441.99 g/mol
LogP4.25
Rot. Bonds4

About 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid

2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid (PubChem CID 174715214) has the molecular formula C14H4Cl4O8 and a molecular weight of 441.99 g/mol. Its IUPAC name is 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid.

Molecular Properties

Compound Name2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid
PubChem CID174715214
Molecular FormulaC14H4Cl4O8
Molecular Weight441.99 g/mol
Exact Mass439.87
IUPAC Name2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid
SMILESO=C(O)c1c(C(=O)O)c(Cl)c2c(C(=O)O)c(Cl)c(Cl)c(C(=O)O)c2c1Cl
InChIInChI=1S/C14H4Cl4O8/c15-7-1-2(8(16)6(14(25)26)5(7)13(23)24)4(12(21)22)10(18)9(17)3(1)11(19)20/h(H,19,20)(H,21,22)(H,23,24)(H,25,26)
InChIKeyBRYMFEHKKKKSRX-UHFFFAOYSA-N
XLogP4.25
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500441.99
LogP ≤ 54.25
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid?
The IUPAC name of 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid (CID 174715214) is 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid.
What is the SMILES notation for 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid?
The canonical SMILES for 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid is O=C(O)c1c(C(=O)O)c(Cl)c2c(C(=O)O)c(Cl)c(Cl)c(C(=O)O)c2c1Cl.
What is the InChIKey of 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid?
The InChIKey is BRYMFEHKKKKSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H4Cl4O8/c15-7-1-2(8(16)6(14(25)26)5(7)13(23)24)4(12(21)22)10(18)9(17)3(1)11(19)20/h(H,19,20)(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid?
2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid has a molecular weight of 441.99 g/mol, XLogP of 4.25, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,8-tetrachloronaphthalene-1,4,6,7-tetracarboxylic acid is sourced from PubChem (CID 174715214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).