C28H10Cl4O15 — CID 139556982
6,7-dichloro-8-(4,5,8-tricarboxy-2,3-dichloronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,4,5-tricarboxylic acid (PubChem CID 139556982) has the molecular formula C28H10Cl4O15 and a molecular weight of 728.18 g/mol. Its IUPAC name is 6,7-dichloro-8-(4,5,8-tricarboxy-2,3-dichloronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,4,5-tricarboxylic acid.
| Compound Name | 6,7-dichloro-8-(4,5,8-tricarboxy-2,3-dichloronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 139556982 |
| Molecular Formula | C28H10Cl4O15 |
| Molecular Weight | 728.18 g/mol |
| Exact Mass | 725.88 |
| IUPAC Name | 6,7-dichloro-8-(4,5,8-tricarboxy-2,3-dichloronaphthalene-1-carbonyl)oxycarbonylnaphthalene-1,4,5-tricarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c2c(C(=O)OC(=O)c3c(Cl)c(Cl)c(C(=O)O)c4c(C(=O)O)ccc(C(=O)O)c34)c(Cl)c(Cl)c(C(=O)O)c12 |
| InChI | InChI=1S/C28H10Cl4O15/c29-17-13(25(41)42)9-5(21(33)34)1-3-7(23(37)38)11(9)15(19(17)31)27(45)47-28(46)16-12-8(24(39)40)4-2-6(22(35)36)10(12)14(26(43)44)18(30)20(16)32/h1-4H,(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | KRBFZRFRKJYTHA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 267.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.18 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|