C12H4Cl6O2 — CID 57039695
3,4,5,6,7,8-hexachloro-2-methylnaphthalene-1-carboxylic acid (PubChem CID 57039695) has the molecular formula C12H4Cl6O2 and a molecular weight of 392.88 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexachloro-2-methylnaphthalene-1-carboxylic acid.
| Compound Name | 3,4,5,6,7,8-hexachloro-2-methylnaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 57039695 |
| Molecular Formula | C12H4Cl6O2 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 389.83 |
| IUPAC Name | 3,4,5,6,7,8-hexachloro-2-methylnaphthalene-1-carboxylic acid |
| SMILES | Cc1c(Cl)c(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2c1C(=O)O |
| InChI | InChI=1S/C12H4Cl6O2/c1-2-3(12(19)20)4-5(8(15)6(2)13)9(16)11(18)10(17)7(4)14/h1H3,(H,19,20) |
| InChIKey | GPTHCAABLFUYLS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|