C16H4Cl8O8Zr — CID 20995095
bis(3,4,5,6-tetrachlorophthalic acid);zirconium (PubChem CID 20995095) has the molecular formula C16H4Cl8O8Zr and a molecular weight of 699.05 g/mol. Its IUPAC name is bis(3,4,5,6-tetrachlorophthalic acid);zirconium.
| Compound Name | bis(3,4,5,6-tetrachlorophthalic acid);zirconium |
|---|---|
| PubChem CID | 20995095 |
| Molecular Formula | C16H4Cl8O8Zr |
| Molecular Weight | 699.05 g/mol |
| Exact Mass | 693.65 |
| IUPAC Name | bis(3,4,5,6-tetrachlorophthalic acid);zirconium |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O.O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O.[Zr] |
| InChI | InChI=1S/2C8H2Cl4O4.Zr/c2*9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;/h2*(H,13,14)(H,15,16); |
| InChIKey | HMGNVIDJFAQOKS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.05 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|