C18H12Br4Cl4N2O8 — CID 88808049
ethane-1,2-diamine;3,4,5,6-tetrabromophthalic acid;3,4,5,6-tetrachlorophthalic acid (PubChem CID 88808049) has the molecular formula C18H12Br4Cl4N2O8 and a molecular weight of 845.73 g/mol. Its IUPAC name is ethane-1,2-diamine;3,4,5,6-tetrabromophthalic acid;3,4,5,6-tetrachlorophthalic acid.
| Compound Name | ethane-1,2-diamine;3,4,5,6-tetrabromophthalic acid;3,4,5,6-tetrachlorophthalic acid |
|---|---|
| PubChem CID | 88808049 |
| Molecular Formula | C18H12Br4Cl4N2O8 |
| Molecular Weight | 845.73 g/mol |
| Exact Mass | 839.61 |
| IUPAC Name | ethane-1,2-diamine;3,4,5,6-tetrabromophthalic acid;3,4,5,6-tetrachlorophthalic acid |
| SMILES | NCCN.O=C(O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)O.O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C8H2Br4O4.C8H2Cl4O4.C2H8N2/c2*9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;3-1-2-4/h2*(H,13,14)(H,15,16);1-4H2 |
| InChIKey | SUGGGENNCXJUDB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.73 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|