C18H8Cl2O8 — CID 175774322
1,4-dichloroanthracene-2,3,6,7-tetracarboxylic acid (PubChem CID 175774322) has the molecular formula C18H8Cl2O8 and a molecular weight of 423.16 g/mol. Its IUPAC name is 1,4-dichloroanthracene-2,3,6,7-tetracarboxylic acid.
| Compound Name | 1,4-dichloroanthracene-2,3,6,7-tetracarboxylic acid |
|---|---|
| PubChem CID | 175774322 |
| Molecular Formula | C18H8Cl2O8 |
| Molecular Weight | 423.16 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 1,4-dichloroanthracene-2,3,6,7-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2cc3c(Cl)c(C(=O)O)c(C(=O)O)c(Cl)c3cc2cc1C(=O)O |
| InChI | InChI=1S/C18H8Cl2O8/c19-13-7-1-5-3-9(15(21)22)10(16(23)24)4-6(5)2-8(7)14(20)12(18(27)28)11(13)17(25)26/h1-4H,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | HPFLIVITXZGGJM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|