C13H4Cl10O5 — CID 57358650
carbonic acid;bis(2,3,4,5,6-pentachlorophenol) (PubChem CID 57358650) has the molecular formula C13H4Cl10O5 and a molecular weight of 594.70 g/mol. Its IUPAC name is carbonic acid;bis(2,3,4,5,6-pentachlorophenol).
| Compound Name | carbonic acid;bis(2,3,4,5,6-pentachlorophenol) |
|---|---|
| PubChem CID | 57358650 |
| Molecular Formula | C13H4Cl10O5 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 589.69 |
| IUPAC Name | carbonic acid;bis(2,3,4,5,6-pentachlorophenol) |
| SMILES | O=C(O)O.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/2C6HCl5O.CH2O3/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;2-1(3)4/h2*12H;(H2,2,3,4) |
| InChIKey | HNHZCNLERVKSFO-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|