C13H9Cl5O — CID 87345161
2,3,4,5,6-pentachlorophenol;toluene (PubChem CID 87345161) has the molecular formula C13H9Cl5O and a molecular weight of 358.48 g/mol. Its IUPAC name is 2,3,4,5,6-pentachlorophenol;toluene.
| Compound Name | 2,3,4,5,6-pentachlorophenol;toluene |
|---|---|
| PubChem CID | 87345161 |
| Molecular Formula | C13H9Cl5O |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 2,3,4,5,6-pentachlorophenol;toluene |
| SMILES | Cc1ccccc1.Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H8.C6HCl5O/c1-7-5-3-2-4-6-7;7-1-2(8)4(10)6(12)5(11)3(1)9/h2-6H,1H3;12H |
| InChIKey | DJDITFKFFNZTFM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|