C28H8F13O7-3 — CID 158920883
2,3,4,5,6-pentafluorobenzoate;2,3,5,6-tetrafluoro-4-methoxybenzoate;2,3,5,6-tetrafluoro-4-phenylbenzoate (PubChem CID 158920883) has the molecular formula C28H8F13O7-3 and a molecular weight of 703.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzoate;2,3,5,6-tetrafluoro-4-methoxybenzoate;2,3,5,6-tetrafluoro-4-phenylbenzoate.
| Compound Name | 2,3,4,5,6-pentafluorobenzoate;2,3,5,6-tetrafluoro-4-methoxybenzoate;2,3,5,6-tetrafluoro-4-phenylbenzoate |
|---|---|
| PubChem CID | 158920883 |
| Molecular Formula | C28H8F13O7-3 |
| Molecular Weight | 703.34 g/mol |
| Exact Mass | 703.01 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzoate;2,3,5,6-tetrafluoro-4-methoxybenzoate;2,3,5,6-tetrafluoro-4-phenylbenzoate |
| SMILES | COc1c(F)c(F)c(C(=O)[O-])c(F)c1F.O=C([O-])c1c(F)c(F)c(-c2ccccc2)c(F)c1F.O=C([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6F4O2.C8H4F4O3.C7HF5O2/c14-9-7(6-4-2-1-3-5-6)10(15)12(17)8(11(9)16)13(18)19;1-15-7-5(11)3(9)2(8(13)14)4(10)6(7)12;8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h1-5H,(H,18,19);1H3,(H,13,14);(H,13,14)/p-3 |
| InChIKey | JHUXPYGMUODMTP-UHFFFAOYSA-K |
| XLogP | 3.63 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|