C14H11F4O4P — CID 132968810
[4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenyl]methylphosphonic acid (PubChem CID 132968810) has the molecular formula C14H11F4O4P and a molecular weight of 350.20 g/mol. Its IUPAC name is [4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenyl]methylphosphonic acid.
| Compound Name | [4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 132968810 |
| Molecular Formula | C14H11F4O4P |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | [4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenyl]methylphosphonic acid |
| SMILES | COc1c(F)c(F)c(-c2ccc(CP(=O)(O)O)cc2)c(F)c1F |
| InChI | InChI=1S/C14H11F4O4P/c1-22-14-12(17)10(15)9(11(16)13(14)18)8-4-2-7(3-5-8)6-23(19,20)21/h2-5H,6H2,1H3,(H2,19,20,21) |
| InChIKey | GZULKYWHZJEFTD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|